C11H16N4O3 — CID 76993162
2,3-dimethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-4-oxobut-2-enoic acid (PubChem CID 76993162) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2,3-dimethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76993162 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2,3-dimethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC(C)c1nncn1C |
| InChI | InChI=1S/C11H16N4O3/c1-6(7(2)11(17)18)10(16)13-8(3)9-14-12-5-15(9)4/h5,8H,1-4H3,(H,13,16)(H,17,18) |
| InChIKey | RFNSBVSTQABHNC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|