C13H21N5O3 — CID 76994064
3-[(4-cyclopropyl-3-oxopyrazin-2-yl)-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide (PubChem CID 76994064) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-[(4-cyclopropyl-3-oxopyrazin-2-yl)-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(4-cyclopropyl-3-oxopyrazin-2-yl)-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 76994064 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 3-[(4-cyclopropyl-3-oxopyrazin-2-yl)-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide |
| SMILES | COCCN(CCC(N)=NO)c1nccn(C2CC2)c1=O |
| InChI | InChI=1S/C13H21N5O3/c1-21-9-8-17(6-4-11(14)16-20)12-13(19)18(7-5-15-12)10-2-3-10/h5,7,10,20H,2-4,6,8-9H2,1H3,(H2,14,16) |
| InChIKey | PCYZXULWTUWALV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|