C17H24O3S — CID 76996115
3-[2-[(3,3,5-trimethylcyclohexyl)oxymethyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 76996115) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is 3-[2-[(3,3,5-trimethylcyclohexyl)oxymethyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[2-[(3,3,5-trimethylcyclohexyl)oxymethyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76996115 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3-[2-[(3,3,5-trimethylcyclohexyl)oxymethyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | CC1CC(OCc2sccc2C=CC(=O)O)CC(C)(C)C1 |
| InChI | InChI=1S/C17H24O3S/c1-12-8-14(10-17(2,3)9-12)20-11-15-13(6-7-21-15)4-5-16(18)19/h4-7,12,14H,8-11H2,1-3H3,(H,18,19) |
| InChIKey | XSJDNDSKDZJASO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|