About 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine
4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine (PubChem CID 76997188) has the molecular formula C13H17F2NO
and a molecular weight of 241.28 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine.
Molecular Properties
| Compound Name | 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine |
| PubChem CID | 76997188 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine |
| SMILES | Cc1cc(C=CCCN)cc(C)c1OC(F)F |
| InChI | InChI=1S/C13H17F2NO/c1-9-7-11(5-3-4-6-16)8-10(2)12(9)17-13(14)15/h3,5,7-8,13H,4,6,16H2,1-2H3 |
| InChIKey | HQRLUJKTEZBKQO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine?
The IUPAC name of 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine (CID 76997188) is 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine.
What is the SMILES notation for 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine?
The canonical SMILES for 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine is Cc1cc(C=CCCN)cc(C)c1OC(F)F.
What is the InChIKey of 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine?
The InChIKey is HQRLUJKTEZBKQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2NO/c1-9-7-11(5-3-4-6-16)8-10(2)12(9)17-13(14)15/h3,5,7-8,13H,4,6,16H2,1-2H3.
What are the key properties of 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine?
4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine has a molecular weight of 241.28 g/mol, XLogP of 3.27, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(difluoromethoxy)-3,5-dimethylphenyl]but-3-en-1-amine is sourced from PubChem (CID 76997188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).