C13H19N3O5 — CID 76999792
4-[(3-morpholin-4-ylpyrrolidine-1-carbonyl)amino]-4-oxobut-2-enoic acid (PubChem CID 76999792) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-[(3-morpholin-4-ylpyrrolidine-1-carbonyl)amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[(3-morpholin-4-ylpyrrolidine-1-carbonyl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76999792 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-[(3-morpholin-4-ylpyrrolidine-1-carbonyl)amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NC(=O)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C13H19N3O5/c17-11(1-2-12(18)19)14-13(20)16-4-3-10(9-16)15-5-7-21-8-6-15/h1-2,10H,3-9H2,(H,18,19)(H,14,17,20) |
| InChIKey | FCWQIJHLCLGLOJ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|