About 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide
3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide (PubChem CID 77002090) has the molecular formula C7H12N4O3
and a molecular weight of 200.20 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide.
Molecular Properties
| Compound Name | 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide |
| PubChem CID | 77002090 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide |
| SMILES | NNC(=O)CCN1CCC(=O)NC1=O |
| InChI | InChI=1S/C7H12N4O3/c8-10-6(13)2-4-11-3-1-5(12)9-7(11)14/h1-4,8H2,(H,10,13)(H,9,12,14) |
| InChIKey | NWSYGUHJJVWUFZ-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide?
The IUPAC name of 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide (CID 77002090) is 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide.
What is the SMILES notation for 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide?
The canonical SMILES for 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide is NNC(=O)CCN1CCC(=O)NC1=O.
What is the InChIKey of 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide?
The InChIKey is NWSYGUHJJVWUFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O3/c8-10-6(13)2-4-11-3-1-5(12)9-7(11)14/h1-4,8H2,(H,10,13)(H,9,12,14).
What are the key properties of 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide?
3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide has a molecular weight of 200.20 g/mol, XLogP of -1.69, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dioxo-1,3-diazinan-1-yl)propanehydrazide is sourced from PubChem (CID 77002090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).