C13H19NO3 — CID 77003544
N-[1-[2-(2-ethoxyethoxy)-4-methylphenyl]ethylidene]hydroxylamine (PubChem CID 77003544) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-[1-[2-(2-ethoxyethoxy)-4-methylphenyl]ethylidene]hydroxylamine.
| Compound Name | N-[1-[2-(2-ethoxyethoxy)-4-methylphenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 77003544 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-[1-[2-(2-ethoxyethoxy)-4-methylphenyl]ethylidene]hydroxylamine |
| SMILES | CCOCCOc1cc(C)ccc1C(C)=NO |
| InChI | InChI=1S/C13H19NO3/c1-4-16-7-8-17-13-9-10(2)5-6-12(13)11(3)14-15/h5-6,9,15H,4,7-8H2,1-3H3 |
| InChIKey | SEFCIWSHZXPERI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|