C15H20FN3O2 — CID 77004275
2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-5-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 77004275) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-5-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-5-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77004275 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-5-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1cc(F)ccc1N1CCOC2CCCCC21 |
| InChI | InChI=1S/C15H20FN3O2/c16-10-5-6-12(11(9-10)15(17)18-20)19-7-8-21-14-4-2-1-3-13(14)19/h5-6,9,13-14,20H,1-4,7-8H2,(H2,17,18) |
| InChIKey | VJTHLLXUSFZIMR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|