About 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid
4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid (PubChem CID 77005693) has the molecular formula C7H10N4O2S
and a molecular weight of 214.25 g/mol. Its IUPAC name is 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid.
Molecular Properties
| Compound Name | 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid |
| PubChem CID | 77005693 |
| Molecular Formula | C7H10N4O2S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)CSc1nncn1N |
| InChI | InChI=1S/C7H10N4O2S/c1-5(2-6(12)13)3-14-7-10-9-4-11(7)8/h2,4H,3,8H2,1H3,(H,12,13) |
| InChIKey | ASZNGCNNKQQHEG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid?
The IUPAC name of 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid (CID 77005693) is 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid.
What is the SMILES notation for 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid?
The canonical SMILES for 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid is CC(=CC(=O)O)CSc1nncn1N.
What is the InChIKey of 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid?
The InChIKey is ASZNGCNNKQQHEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2S/c1-5(2-6(12)13)3-14-7-10-9-4-11(7)8/h2,4H,3,8H2,1H3,(H,12,13).
What are the key properties of 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid?
4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid has a molecular weight of 214.25 g/mol, XLogP of 0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-3-methylbut-2-enoic acid is sourced from PubChem (CID 77005693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).