C14H15NO4S — CID 77006881
3-[3-(4-hydroxyphenyl)prop-2-enoyl]-2-methyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 77006881) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 3-[3-(4-hydroxyphenyl)prop-2-enoyl]-2-methyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-[3-(4-hydroxyphenyl)prop-2-enoyl]-2-methyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 77006881 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-[3-(4-hydroxyphenyl)prop-2-enoyl]-2-methyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1SCC(C(=O)O)N1C(=O)C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H15NO4S/c1-9-15(12(8-20-9)14(18)19)13(17)7-4-10-2-5-11(16)6-3-10/h2-7,9,12,16H,8H2,1H3,(H,18,19) |
| InChIKey | IBEFORPIBDQZEN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|