C14H21N3O2S — CID 77008681
N'-hydroxy-2-(3-methoxypropylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carboximidamide (PubChem CID 77008681) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is N'-hydroxy-2-(3-methoxypropylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carboximidamide.
| Compound Name | N'-hydroxy-2-(3-methoxypropylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carboximidamide |
|---|---|
| PubChem CID | 77008681 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N'-hydroxy-2-(3-methoxypropylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carboximidamide |
| SMILES | COCCCSc1nc2c(cc1C(N)=NO)CCCC2 |
| InChI | InChI=1S/C14H21N3O2S/c1-19-7-4-8-20-14-11(13(15)17-18)9-10-5-2-3-6-12(10)16-14/h9,18H,2-8H2,1H3,(H2,15,17) |
| InChIKey | CFDDAGHKUYXLPB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|