About N-benzyl-4-ethoxyaniline
N-benzyl-4-ethoxyaniline (PubChem CID 770112) has the molecular formula C15H17NO
and a molecular weight of 227.31 g/mol. Its IUPAC name is N-benzyl-4-ethoxyaniline.
Molecular Properties
| Compound Name | N-benzyl-4-ethoxyaniline |
| PubChem CID | 770112 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-benzyl-4-ethoxyaniline |
| SMILES | CCOc1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H17NO/c1-2-17-15-10-8-14(9-11-15)16-12-13-6-4-3-5-7-13/h3-11,16H,2,12H2,1H3 |
| InChIKey | ZAUVBVZMMZMKSQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-ethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-ethoxyaniline?
The IUPAC name of N-benzyl-4-ethoxyaniline (CID 770112) is N-benzyl-4-ethoxyaniline.
What is the SMILES notation for N-benzyl-4-ethoxyaniline?
The canonical SMILES for N-benzyl-4-ethoxyaniline is CCOc1ccc(NCc2ccccc2)cc1.
What is the InChIKey of N-benzyl-4-ethoxyaniline?
The InChIKey is ZAUVBVZMMZMKSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO/c1-2-17-15-10-8-14(9-11-15)16-12-13-6-4-3-5-7-13/h3-11,16H,2,12H2,1H3.
What are the key properties of N-benzyl-4-ethoxyaniline?
N-benzyl-4-ethoxyaniline has a molecular weight of 227.31 g/mol, XLogP of 3.70, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-ethoxyaniline is sourced from PubChem (CID 770112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).