About 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol
3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol (PubChem CID 77011342) has the molecular formula C10H23N3O2
and a molecular weight of 217.31 g/mol. Its IUPAC name is 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol |
| PubChem CID | 77011342 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol |
| SMILES | CN1CCN(C)C(CNCC(O)CO)C1 |
| InChI | InChI=1S/C10H23N3O2/c1-12-3-4-13(2)9(7-12)5-11-6-10(15)8-14/h9-11,14-15H,3-8H2,1-2H3 |
| InChIKey | REVMSCIQPDYZIL-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol?
The IUPAC name of 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol (CID 77011342) is 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol.
What is the SMILES notation for 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol?
The canonical SMILES for 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol is CN1CCN(C)C(CNCC(O)CO)C1.
What is the InChIKey of 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol?
The InChIKey is REVMSCIQPDYZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3O2/c1-12-3-4-13(2)9(7-12)5-11-6-10(15)8-14/h9-11,14-15H,3-8H2,1-2H3.
What are the key properties of 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol?
3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol has a molecular weight of 217.31 g/mol, XLogP of -1.83, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,4-dimethylpiperazin-2-yl)methylamino]propane-1,2-diol is sourced from PubChem (CID 77011342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).