C18H25N3OS — CID 770116
1-amino-N,N,5-triethyl-6,7,8,9-tetrahydrothieno[2,3-c]isoquinoline-2-carboxamide (PubChem CID 770116) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is 1-amino-N,N,5-triethyl-6,7,8,9-tetrahydrothieno[2,3-c]isoquinoline-2-carboxamide.
| Compound Name | 1-amino-N,N,5-triethyl-6,7,8,9-tetrahydrothieno[2,3-c]isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 770116 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-amino-N,N,5-triethyl-6,7,8,9-tetrahydrothieno[2,3-c]isoquinoline-2-carboxamide |
| SMILES | CCc1nc2sc(C(=O)N(CC)CC)c(N)c2c2c1CCCC2 |
| InChI | InChI=1S/C18H25N3OS/c1-4-13-11-9-7-8-10-12(11)14-15(19)16(23-17(14)20-13)18(22)21(5-2)6-3/h4-10,19H2,1-3H3 |
| InChIKey | PDAZLHLBPNHONI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |