C11H19N7O3 — CID 77011987
2-[4-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperazin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 77011987) has the molecular formula C11H19N7O3 and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-[4-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperazin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperazin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77011987 |
| Molecular Formula | C11H19N7O3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-[4-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperazin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | COc1nc(OC)nc(N2CCN(CC(N)=NO)CC2)n1 |
| InChI | InChI=1S/C11H19N7O3/c1-20-10-13-9(14-11(15-10)21-2)18-5-3-17(4-6-18)7-8(12)16-19/h19H,3-7H2,1-2H3,(H2,12,16) |
| InChIKey | NARGLLODIXJWGZ-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|