C14H21N5O2 — CID 77012824
N'-hydroxy-2-methyl-2-[4-(pyridine-3-carbonyl)piperazin-1-yl]propanimidamide (PubChem CID 77012824) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-2-[4-(pyridine-3-carbonyl)piperazin-1-yl]propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-2-[4-(pyridine-3-carbonyl)piperazin-1-yl]propanimidamide |
|---|---|
| PubChem CID | 77012824 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N'-hydroxy-2-methyl-2-[4-(pyridine-3-carbonyl)piperazin-1-yl]propanimidamide |
| SMILES | CC(C)(C(N)=NO)N1CCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C14H21N5O2/c1-14(2,13(15)17-21)19-8-6-18(7-9-19)12(20)11-4-3-5-16-10-11/h3-5,10,21H,6-9H2,1-2H3,(H2,15,17) |
| InChIKey | GXALUXRSEKFERN-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|