About 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine
1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine (PubChem CID 77012948) has the molecular formula C9H17ClN2
and a molecular weight of 188.70 g/mol. Its IUPAC name is 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine |
| PubChem CID | 77012948 |
| Molecular Formula | C9H17ClN2 |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine |
| SMILES | CC1CNCC(C)N1CC=CCl |
| InChI | InChI=1S/C9H17ClN2/c1-8-6-11-7-9(2)12(8)5-3-4-10/h3-4,8-9,11H,5-7H2,1-2H3 |
| InChIKey | PUYWGZIQUZQXOD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine?
The IUPAC name of 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine (CID 77012948) is 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine.
What is the SMILES notation for 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine?
The canonical SMILES for 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine is CC1CNCC(C)N1CC=CCl.
What is the InChIKey of 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine?
The InChIKey is PUYWGZIQUZQXOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17ClN2/c1-8-6-11-7-9(2)12(8)5-3-4-10/h3-4,8-9,11H,5-7H2,1-2H3.
What are the key properties of 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine?
1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine has a molecular weight of 188.70 g/mol, XLogP of 1.42, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloroprop-2-enyl)-2,6-dimethylpiperazine is sourced from PubChem (CID 77012948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).