C16H22N2O3 — CID 77013118
3-[5-(5-methylhexan-2-ylcarbamoyl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 77013118) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-[5-(5-methylhexan-2-ylcarbamoyl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[5-(5-methylhexan-2-ylcarbamoyl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77013118 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 3-[5-(5-methylhexan-2-ylcarbamoyl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | CC(C)CCC(C)NC(=O)c1cncc(C=CC(=O)O)c1 |
| InChI | InChI=1S/C16H22N2O3/c1-11(2)4-5-12(3)18-16(21)14-8-13(9-17-10-14)6-7-15(19)20/h6-12H,4-5H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | SQDCJFLVBNSCNX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|