C12H17N3O3S — CID 77013325
2-[(4-methyl-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]oxyacetic acid (PubChem CID 77013325) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-[(4-methyl-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]oxyacetic acid.
| Compound Name | 2-[(4-methyl-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 77013325 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-[(4-methyl-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]oxyacetic acid |
| SMILES | Cc1nc(N2CCCCC2)sc1C=NOCC(=O)O |
| InChI | InChI=1S/C12H17N3O3S/c1-9-10(7-13-18-8-11(16)17)19-12(14-9)15-5-3-2-4-6-15/h7H,2-6,8H2,1H3,(H,16,17) |
| InChIKey | CBYNZJFQXZURDO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|