About ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate
ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate (PubChem CID 77014348) has the molecular formula C23H25Cl2N3O3
and a molecular weight of 462.38 g/mol. Its IUPAC name is ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate |
| PubChem CID | 77014348 |
| Molecular Formula | C23H25Cl2N3O3 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate |
| SMILES | CCCC(C(=O)NCC(=O)OCC)n1c(Cc2ccccc2)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C23H25Cl2N3O3/c1-3-8-19(23(30)26-14-22(29)31-4-2)28-20-13-17(25)16(24)12-18(20)27-21(28)11-15-9-6-5-7-10-15/h5-7,9-10,12-13,19H,3-4,8,11,14H2,1-2H3,(H,26,30) |
| InChIKey | NJKINVSSHGFKCS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate?
The IUPAC name of ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate (CID 77014348) is ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate.
What is the SMILES notation for ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate?
The canonical SMILES for ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate is CCCC(C(=O)NCC(=O)OCC)n1c(Cc2ccccc2)nc2cc(Cl)c(Cl)cc21.
What is the InChIKey of ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate?
The InChIKey is NJKINVSSHGFKCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25Cl2N3O3/c1-3-8-19(23(30)26-14-22(29)31-4-2)28-20-13-17(25)16(24)12-18(20)27-21(28)11-15-9-6-5-7-10-15/h5-7,9-10,12-13,19H,3-4,8,11,14H2,1-2H3,(H,26,30).
What are the key properties of ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate?
ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate has a molecular weight of 462.38 g/mol, XLogP of 4.95, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)pentanoylamino]acetate is sourced from PubChem (CID 77014348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).