About 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile
3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile (PubChem CID 77015271) has the molecular formula C8H12ClNO2S
and a molecular weight of 221.71 g/mol. Its IUPAC name is 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile.
Molecular Properties
| Compound Name | 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile |
| PubChem CID | 77015271 |
| Molecular Formula | C8H12ClNO2S |
| Molecular Weight | 221.71 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile |
| SMILES | CC(C#N)=C(Cl)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C8H12ClNO2S/c1-6(5-10)7(9)8(2,3)13(4,11)12/h1-4H3 |
| InChIKey | HFHLCVJNAJWFBC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.71 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile?
The IUPAC name of 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile (CID 77015271) is 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile.
What is the SMILES notation for 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile?
The canonical SMILES for 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile is CC(C#N)=C(Cl)C(C)(C)S(C)(=O)=O.
What is the InChIKey of 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile?
The InChIKey is HFHLCVJNAJWFBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClNO2S/c1-6(5-10)7(9)8(2,3)13(4,11)12/h1-4H3.
What are the key properties of 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile?
3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile has a molecular weight of 221.71 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,4-dimethyl-4-methylsulfonylpent-2-enenitrile is sourced from PubChem (CID 77015271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).