About N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide
N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide (PubChem CID 77015636) has the molecular formula C12H25N3O2
and a molecular weight of 243.35 g/mol. Its IUPAC name is N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide |
| PubChem CID | 77015636 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide |
| SMILES | CCC(CC)(NC(=O)C(C)C(C)C)C(N)=NO |
| InChI | InChI=1S/C12H25N3O2/c1-6-12(7-2,11(13)15-17)14-10(16)9(5)8(3)4/h8-9,17H,6-7H2,1-5H3,(H2,13,15)(H,14,16) |
| InChIKey | QZWJGCLCUXVSIW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide?
The IUPAC name of N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide (CID 77015636) is N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide.
What is the SMILES notation for N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide?
The canonical SMILES for N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide is CCC(CC)(NC(=O)C(C)C(C)C)C(N)=NO.
What is the InChIKey of N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide?
The InChIKey is QZWJGCLCUXVSIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O2/c1-6-12(7-2,11(13)15-17)14-10(16)9(5)8(3)4/h8-9,17H,6-7H2,1-5H3,(H2,13,15)(H,14,16).
What are the key properties of N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide?
N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide has a molecular weight of 243.35 g/mol, XLogP of 1.70, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(N'-hydroxycarbamimidoyl)pentan-3-yl]-2,3-dimethylbutanamide is sourced from PubChem (CID 77015636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).