About N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide
N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide (PubChem CID 77016547) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide |
| PubChem CID | 77016547 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide |
| SMILES | CC1(C)CCCN(C(N)=NO)C1 |
| InChI | InChI=1S/C8H17N3O/c1-8(2)4-3-5-11(6-8)7(9)10-12/h12H,3-6H2,1-2H3,(H2,9,10) |
| InChIKey | WALBPIQORWQGBB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide?
The IUPAC name of N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide (CID 77016547) is N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide.
What is the SMILES notation for N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide?
The canonical SMILES for N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide is CC1(C)CCCN(C(N)=NO)C1.
What is the InChIKey of N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide?
The InChIKey is WALBPIQORWQGBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O/c1-8(2)4-3-5-11(6-8)7(9)10-12/h12H,3-6H2,1-2H3,(H2,9,10).
What are the key properties of N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide?
N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide has a molecular weight of 171.24 g/mol, XLogP of 0.81, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-3,3-dimethylpiperidine-1-carboximidamide is sourced from PubChem (CID 77016547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).