About 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide
2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide (PubChem CID 77017042) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide |
| PubChem CID | 77017042 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide |
| SMILES | CN(CC(N)=NO)CC1CC2CCC1C2 |
| InChI | InChI=1S/C11H21N3O/c1-14(7-11(12)13-15)6-10-5-8-2-3-9(10)4-8/h8-10,15H,2-7H2,1H3,(H2,12,13) |
| InChIKey | BJYMUYYXTRPXBU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide (CID 77017042) is 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide is CN(CC(N)=NO)CC1CC2CCC1C2.
What is the InChIKey of 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide?
The InChIKey is BJYMUYYXTRPXBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-14(7-11(12)13-15)6-10-5-8-2-3-9(10)4-8/h8-10,15H,2-7H2,1H3,(H2,12,13).
What are the key properties of 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide?
2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide has a molecular weight of 211.31 g/mol, XLogP of 1.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]-N'-hydroxyethanimidamide is sourced from PubChem (CID 77017042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).