C6H7F3N2O2 — CID 77019819
1-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4-dione (PubChem CID 77019819) has the molecular formula C6H7F3N2O2 and a molecular weight of 196.13 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 77019819 |
| Molecular Formula | C6H7F3N2O2 |
| Molecular Weight | 196.13 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(CC(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C6H7F3N2O2/c7-6(8,9)3-11-2-1-4(12)10-5(11)13/h1-3H2,(H,10,12,13) |
| InChIKey | XEILHGMINQBMQP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.13 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |