About N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide
N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide (PubChem CID 77021392) has the molecular formula C6H11N5OS
and a molecular weight of 201.25 g/mol. Its IUPAC name is N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide.
Molecular Properties
| Compound Name | N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide |
| PubChem CID | 77021392 |
| Molecular Formula | C6H11N5OS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide |
| SMILES | CN(CCC(N)=NO)c1nncs1 |
| InChI | InChI=1S/C6H11N5OS/c1-11(3-2-5(7)10-12)6-9-8-4-13-6/h4,12H,2-3H2,1H3,(H2,7,10) |
| InChIKey | QIRSOMOHWGORDZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide?
The IUPAC name of N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide (CID 77021392) is N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide.
What is the SMILES notation for N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide?
The canonical SMILES for N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide is CN(CCC(N)=NO)c1nncs1.
What is the InChIKey of N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide?
The InChIKey is QIRSOMOHWGORDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5OS/c1-11(3-2-5(7)10-12)6-9-8-4-13-6/h4,12H,2-3H2,1H3,(H2,7,10).
What are the key properties of N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide?
N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide has a molecular weight of 201.25 g/mol, XLogP of 0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-3-[methyl(1,3,4-thiadiazol-2-yl)amino]propanimidamide is sourced from PubChem (CID 77021392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).