C16H24FN3O — CID 77024723
3-fluoro-N'-hydroxy-4-(4-propan-2-ylazepan-1-yl)benzenecarboximidamide (PubChem CID 77024723) has the molecular formula C16H24FN3O and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-fluoro-N'-hydroxy-4-(4-propan-2-ylazepan-1-yl)benzenecarboximidamide.
| Compound Name | 3-fluoro-N'-hydroxy-4-(4-propan-2-ylazepan-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 77024723 |
| Molecular Formula | C16H24FN3O |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 3-fluoro-N'-hydroxy-4-(4-propan-2-ylazepan-1-yl)benzenecarboximidamide |
| SMILES | CC(C)C1CCCN(c2ccc(C(N)=NO)cc2F)CC1 |
| InChI | InChI=1S/C16H24FN3O/c1-11(2)12-4-3-8-20(9-7-12)15-6-5-13(10-14(15)17)16(18)19-21/h5-6,10-12,21H,3-4,7-9H2,1-2H3,(H2,18,19) |
| InChIKey | MZPNBSZXRPRXPI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|