About 3-(1-adamantylamino)-N'-hydroxypropanimidamide
3-(1-adamantylamino)-N'-hydroxypropanimidamide (PubChem CID 77025402) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-(1-adamantylamino)-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-(1-adamantylamino)-N'-hydroxypropanimidamide |
| PubChem CID | 77025402 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3-(1-adamantylamino)-N'-hydroxypropanimidamide |
| SMILES | NC(CCNC12CC3CC(CC(C3)C1)C2)=NO |
| InChI | InChI=1S/C13H23N3O/c14-12(16-17)1-2-15-13-6-9-3-10(7-13)5-11(4-9)8-13/h9-11,15,17H,1-8H2,(H2,14,16) |
| InChIKey | PTUZUYCVRWESEA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-adamantylamino)-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-adamantylamino)-N'-hydroxypropanimidamide?
The IUPAC name of 3-(1-adamantylamino)-N'-hydroxypropanimidamide (CID 77025402) is 3-(1-adamantylamino)-N'-hydroxypropanimidamide.
What is the SMILES notation for 3-(1-adamantylamino)-N'-hydroxypropanimidamide?
The canonical SMILES for 3-(1-adamantylamino)-N'-hydroxypropanimidamide is NC(CCNC12CC3CC(CC(C3)C1)C2)=NO.
What is the InChIKey of 3-(1-adamantylamino)-N'-hydroxypropanimidamide?
The InChIKey is PTUZUYCVRWESEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O/c14-12(16-17)1-2-15-13-6-9-3-10(7-13)5-11(4-9)8-13/h9-11,15,17H,1-8H2,(H2,14,16).
What are the key properties of 3-(1-adamantylamino)-N'-hydroxypropanimidamide?
3-(1-adamantylamino)-N'-hydroxypropanimidamide has a molecular weight of 237.35 g/mol, XLogP of 1.68, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-adamantylamino)-N'-hydroxypropanimidamide is sourced from PubChem (CID 77025402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).