About 4-(1-adamantylamino)-N'-hydroxybutanimidamide
4-(1-adamantylamino)-N'-hydroxybutanimidamide (PubChem CID 77025532) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-(1-adamantylamino)-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 4-(1-adamantylamino)-N'-hydroxybutanimidamide |
| PubChem CID | 77025532 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 4-(1-adamantylamino)-N'-hydroxybutanimidamide |
| SMILES | NC(CCCNC12CC3CC(CC(C3)C1)C2)=NO |
| InChI | InChI=1S/C14H25N3O/c15-13(17-18)2-1-3-16-14-7-10-4-11(8-14)6-12(5-10)9-14/h10-12,16,18H,1-9H2,(H2,15,17) |
| InChIKey | MFOUDIIYOFKHAR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-adamantylamino)-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-adamantylamino)-N'-hydroxybutanimidamide?
The IUPAC name of 4-(1-adamantylamino)-N'-hydroxybutanimidamide (CID 77025532) is 4-(1-adamantylamino)-N'-hydroxybutanimidamide.
What is the SMILES notation for 4-(1-adamantylamino)-N'-hydroxybutanimidamide?
The canonical SMILES for 4-(1-adamantylamino)-N'-hydroxybutanimidamide is NC(CCCNC12CC3CC(CC(C3)C1)C2)=NO.
What is the InChIKey of 4-(1-adamantylamino)-N'-hydroxybutanimidamide?
The InChIKey is MFOUDIIYOFKHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O/c15-13(17-18)2-1-3-16-14-7-10-4-11(8-14)6-12(5-10)9-14/h10-12,16,18H,1-9H2,(H2,15,17).
What are the key properties of 4-(1-adamantylamino)-N'-hydroxybutanimidamide?
4-(1-adamantylamino)-N'-hydroxybutanimidamide has a molecular weight of 251.37 g/mol, XLogP of 2.07, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-adamantylamino)-N'-hydroxybutanimidamide is sourced from PubChem (CID 77025532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).