C13H16N4O3 — CID 77026685
N'-hydroxy-3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]butanimidamide (PubChem CID 77026685) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is N'-hydroxy-3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]butanimidamide.
| Compound Name | N'-hydroxy-3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]butanimidamide |
|---|---|
| PubChem CID | 77026685 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N'-hydroxy-3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]butanimidamide |
| SMILES | CC(CC(N)=NO)Nc1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C13H16N4O3/c1-7(5-11(14)16-20)15-8-3-4-9-10(6-8)13(19)17(2)12(9)18/h3-4,6-7,15,20H,5H2,1-2H3,(H2,14,16) |
| InChIKey | YGVGULXOCSULSZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|