C11H24N4O — CID 77028625
2-[(1-ethylpyrrolidin-3-yl)methylamino]-N'-hydroxybutanimidamide (PubChem CID 77028625) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-[(1-ethylpyrrolidin-3-yl)methylamino]-N'-hydroxybutanimidamide.
| Compound Name | 2-[(1-ethylpyrrolidin-3-yl)methylamino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 77028625 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 2-[(1-ethylpyrrolidin-3-yl)methylamino]-N'-hydroxybutanimidamide |
| SMILES | CCC(NCC1CCN(CC)C1)C(N)=NO |
| InChI | InChI=1S/C11H24N4O/c1-3-10(11(12)14-16)13-7-9-5-6-15(4-2)8-9/h9-10,13,16H,3-8H2,1-2H3,(H2,12,14) |
| InChIKey | FZOYTYBHHISNLX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|