C12H19N3O — CID 77028641
N'-hydroxy-2-[2-(3-methylphenyl)ethylamino]propanimidamide (PubChem CID 77028641) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N'-hydroxy-2-[2-(3-methylphenyl)ethylamino]propanimidamide.
| Compound Name | N'-hydroxy-2-[2-(3-methylphenyl)ethylamino]propanimidamide |
|---|---|
| PubChem CID | 77028641 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N'-hydroxy-2-[2-(3-methylphenyl)ethylamino]propanimidamide |
| SMILES | Cc1cccc(CCNC(C)C(N)=NO)c1 |
| InChI | InChI=1S/C12H19N3O/c1-9-4-3-5-11(8-9)6-7-14-10(2)12(13)15-16/h3-5,8,10,14,16H,6-7H2,1-2H3,(H2,13,15) |
| InChIKey | YCXJRWFVTLLFRN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|