About 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide
4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide (PubChem CID 77028778) has the molecular formula C11H15Br2N3O
and a molecular weight of 365.07 g/mol. Its IUPAC name is 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide |
| PubChem CID | 77028778 |
| Molecular Formula | C11H15Br2N3O |
| Molecular Weight | 365.07 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide |
| SMILES | Cc1cc(Br)c(NCCCC(N)=NO)c(Br)c1 |
| InChI | InChI=1S/C11H15Br2N3O/c1-7-5-8(12)11(9(13)6-7)15-4-2-3-10(14)16-17/h5-6,15,17H,2-4H2,1H3,(H2,14,16) |
| InChIKey | RPAPYWHBTKHWJE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.07 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide?
The IUPAC name of 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide (CID 77028778) is 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide.
What is the SMILES notation for 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide?
The canonical SMILES for 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide is Cc1cc(Br)c(NCCCC(N)=NO)c(Br)c1.
What is the InChIKey of 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide?
The InChIKey is RPAPYWHBTKHWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Br2N3O/c1-7-5-8(12)11(9(13)6-7)15-4-2-3-10(14)16-17/h5-6,15,17H,2-4H2,1H3,(H2,14,16).
What are the key properties of 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide?
4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide has a molecular weight of 365.07 g/mol, XLogP of 3.46, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-dibromo-4-methylanilino)-N'-hydroxybutanimidamide is sourced from PubChem (CID 77028778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).