C7H14N4O2 — CID 77030299
N'-hydroxy-2-[(2-oxopiperidin-3-yl)amino]ethanimidamide (PubChem CID 77030299) has the molecular formula C7H14N4O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is N'-hydroxy-2-[(2-oxopiperidin-3-yl)amino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[(2-oxopiperidin-3-yl)amino]ethanimidamide |
|---|---|
| PubChem CID | 77030299 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | N'-hydroxy-2-[(2-oxopiperidin-3-yl)amino]ethanimidamide |
| SMILES | NC(CNC1CCCNC1=O)=NO |
| InChI | InChI=1S/C7H14N4O2/c8-6(11-13)4-10-5-2-1-3-9-7(5)12/h5,10,13H,1-4H2,(H2,8,11)(H,9,12) |
| InChIKey | ZAWZPPGTNMIGGK-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|