C12H13F3N2O2 — CID 77033652
1,1,1-trifluoro-3-(4-hydroxyimino-2,3-dihydroquinolin-1-yl)propan-2-ol (PubChem CID 77033652) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(4-hydroxyimino-2,3-dihydroquinolin-1-yl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-(4-hydroxyimino-2,3-dihydroquinolin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 77033652 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1,1,1-trifluoro-3-(4-hydroxyimino-2,3-dihydroquinolin-1-yl)propan-2-ol |
| SMILES | ON=C1CCN(CC(O)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C12H13F3N2O2/c13-12(14,15)11(18)7-17-6-5-9(16-19)8-3-1-2-4-10(8)17/h1-4,11,18-19H,5-7H2 |
| InChIKey | RITBMGUHRQVORG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|