C25H32N6 — CID 7703671
8-ethyl-N-[(Z)-[(1S,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 7703671) has the molecular formula C25H32N6 and a molecular weight of 416.57 g/mol. Its IUPAC name is 8-ethyl-N-[(Z)-[(1S,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 8-ethyl-N-[(Z)-[(1S,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 7703671 |
| Molecular Formula | C25H32N6 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 8-ethyl-N-[(Z)-[(1S,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCc1ccc2[nH]c3nc(N/N=C\[C@H]4CC=C(CCC=C(C)C)C[C@@H]4C)nnc3c2c1 |
| InChI | InChI=1S/C25H32N6/c1-5-18-10-12-22-21(14-18)23-24(27-22)28-25(31-29-23)30-26-15-20-11-9-19(13-17(20)4)8-6-7-16(2)3/h7,9-10,12,14-15,17,20H,5-6,8,11,13H2,1-4H3,(H2,27,28,30,31)/b26-15-/t17-,20+/m0/s1 |
| InChIKey | GVWCFPPDEZEYPF-CWICUVHRSA-N |
| XLogP | 6.19 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|