C9H12BrN3OS — CID 77037125
3-[(5-bromo-2-pyridinyl)sulfanyl]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 77037125) has the molecular formula C9H12BrN3OS and a molecular weight of 290.19 g/mol. Its IUPAC name is 3-[(5-bromo-2-pyridinyl)sulfanyl]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-[(5-bromo-2-pyridinyl)sulfanyl]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 77037125 |
| Molecular Formula | C9H12BrN3OS |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 3-[(5-bromo-2-pyridinyl)sulfanyl]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CC(CSc1ccc(Br)cn1)C(N)=NO |
| InChI | InChI=1S/C9H12BrN3OS/c1-6(9(11)13-14)5-15-8-3-2-7(10)4-12-8/h2-4,6,14H,5H2,1H3,(H2,11,13) |
| InChIKey | FPLFJVLZEVODOX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|