About 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide
2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide (PubChem CID 77037895) has the molecular formula C12H25N3O3S
and a molecular weight of 291.42 g/mol. Its IUPAC name is 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide |
| PubChem CID | 77037895 |
| Molecular Formula | C12H25N3O3S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide |
| SMILES | CC(C)N(CC(N)=NO)S(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C12H25N3O3S/c1-10(2)15(8-12(13)14-16)19(17,18)9-11-6-4-3-5-7-11/h10-11,16H,3-9H2,1-2H3,(H2,13,14) |
| InChIKey | GYWQYQJYJBOXGF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide (CID 77037895) is 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide is CC(C)N(CC(N)=NO)S(=O)(=O)CC1CCCCC1.
What is the InChIKey of 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide?
The InChIKey is GYWQYQJYJBOXGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O3S/c1-10(2)15(8-12(13)14-16)19(17,18)9-11-6-4-3-5-7-11/h10-11,16H,3-9H2,1-2H3,(H2,13,14).
What are the key properties of 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide?
2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide has a molecular weight of 291.42 g/mol, XLogP of 1.35, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclohexylmethylsulfonyl(propan-2-yl)amino]-N'-hydroxyethanimidamide is sourced from PubChem (CID 77037895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).