C10H16N4O3 — CID 77039167
N-(1-amino-1-hydroxyimino-3-methylbutan-2-yl)-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 77039167) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-(1-amino-1-hydroxyimino-3-methylbutan-2-yl)-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(1-amino-1-hydroxyimino-3-methylbutan-2-yl)-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 77039167 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | N-(1-amino-1-hydroxyimino-3-methylbutan-2-yl)-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C(N)=NO)C(C)C)on1 |
| InChI | InChI=1S/C10H16N4O3/c1-5(2)8(9(11)13-16)12-10(15)7-4-6(3)14-17-7/h4-5,8,16H,1-3H3,(H2,11,13)(H,12,15) |
| InChIKey | KAPBCRMLMPGIHX-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|