C12H11N3O2S — CID 77040071
3-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]pyrrolidine-2,5-dione (PubChem CID 77040071) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 3-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 77040071 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 3-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]pyrrolidine-2,5-dione |
| SMILES | Cc1nc2scc(C)n2c1C=C1CC(=O)NC1=O |
| InChI | InChI=1S/C12H11N3O2S/c1-6-5-18-12-13-7(2)9(15(6)12)3-8-4-10(16)14-11(8)17/h3,5H,4H2,1-2H3,(H,14,16,17) |
| InChIKey | PYYKFTMSWOCJFW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|