C13H11F2NO3 — CID 77040399
3-[1-[4-(difluoromethoxy)phenyl]ethylidene]pyrrolidine-2,5-dione (PubChem CID 77040399) has the molecular formula C13H11F2NO3 and a molecular weight of 267.23 g/mol. Its IUPAC name is 3-[1-[4-(difluoromethoxy)phenyl]ethylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[1-[4-(difluoromethoxy)phenyl]ethylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 77040399 |
| Molecular Formula | C13H11F2NO3 |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-[1-[4-(difluoromethoxy)phenyl]ethylidene]pyrrolidine-2,5-dione |
| SMILES | CC(=C1CC(=O)NC1=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H11F2NO3/c1-7(10-6-11(17)16-12(10)18)8-2-4-9(5-3-8)19-13(14)15/h2-5,13H,6H2,1H3,(H,16,17,18) |
| InChIKey | MVJGPVMFQNEIKY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|