About 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine
4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine (PubChem CID 77040467) has the molecular formula C9H6Br2N2S2
and a molecular weight of 366.10 g/mol. Its IUPAC name is 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine |
| PubChem CID | 77040467 |
| Molecular Formula | C9H6Br2N2S2 |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 363.83 |
| IUPAC Name | 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(C=Cc2cc(Br)sc2Br)cs1 |
| InChI | InChI=1S/C9H6Br2N2S2/c10-7-3-5(8(11)15-7)1-2-6-4-14-9(12)13-6/h1-4H,(H2,12,13) |
| InChIKey | XBPQDOCIDFNZTQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine?
The IUPAC name of 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine (CID 77040467) is 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine?
The canonical SMILES for 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine is Nc1nc(C=Cc2cc(Br)sc2Br)cs1.
What is the InChIKey of 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine?
The InChIKey is XBPQDOCIDFNZTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Br2N2S2/c10-7-3-5(8(11)15-7)1-2-6-4-14-9(12)13-6/h1-4H,(H2,12,13).
What are the key properties of 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine?
4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine has a molecular weight of 366.10 g/mol, XLogP of 4.48, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,5-dibromothiophen-3-yl)ethenyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 77040467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).