C13H15ClFN3O2 — CID 77041378
1-(5-chloro-2-fluorobenzoyl)-N'-hydroxypiperidine-3-carboximidamide (PubChem CID 77041378) has the molecular formula C13H15ClFN3O2 and a molecular weight of 299.73 g/mol. Its IUPAC name is 1-(5-chloro-2-fluorobenzoyl)-N'-hydroxypiperidine-3-carboximidamide.
| Compound Name | 1-(5-chloro-2-fluorobenzoyl)-N'-hydroxypiperidine-3-carboximidamide |
|---|---|
| PubChem CID | 77041378 |
| Molecular Formula | C13H15ClFN3O2 |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-(5-chloro-2-fluorobenzoyl)-N'-hydroxypiperidine-3-carboximidamide |
| SMILES | NC(=NO)C1CCCN(C(=O)c2cc(Cl)ccc2F)C1 |
| InChI | InChI=1S/C13H15ClFN3O2/c14-9-3-4-11(15)10(6-9)13(19)18-5-1-2-8(7-18)12(16)17-20/h3-4,6,8,20H,1-2,5,7H2,(H2,16,17) |
| InChIKey | UTJWDNBSRUCYGS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|