C11H21N3O — CID 77045511
3-(2-bicyclo[2.2.1]heptanylamino)-N'-hydroxybutanimidamide (PubChem CID 77045511) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanylamino)-N'-hydroxybutanimidamide.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanylamino)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 77045511 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanylamino)-N'-hydroxybutanimidamide |
| SMILES | CC(CC(N)=NO)NC1CC2CCC1C2 |
| InChI | InChI=1S/C11H21N3O/c1-7(4-11(12)14-15)13-10-6-8-2-3-9(10)5-8/h7-10,13,15H,2-6H2,1H3,(H2,12,14) |
| InChIKey | DLHQLLPXPXUTSH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|