C8H12N4O — CID 77045656
N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide (PubChem CID 77045656) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide.
| Compound Name | N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide |
|---|---|
| PubChem CID | 77045656 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)but-2-enamide |
| SMILES | CC=CC(=O)N(C)Cc1ncn[nH]1 |
| InChI | InChI=1S/C8H12N4O/c1-3-4-8(13)12(2)5-7-9-6-10-11-7/h3-4,6H,5H2,1-2H3,(H,9,10,11) |
| InChIKey | KOJVFOBJJXLLQK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|