C11H16N4O — CID 77045826
N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]hexa-2,4-dienamide (PubChem CID 77045826) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]hexa-2,4-dienamide.
| Compound Name | N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 77045826 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)N(C)Cc1n[nH]c(C)n1 |
| InChI | InChI=1S/C11H16N4O/c1-4-5-6-7-11(16)15(3)8-10-12-9(2)13-14-10/h4-7H,8H2,1-3H3,(H,12,13,14) |
| InChIKey | NXMSTGFVTOOLBB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|