C11H14N4O3 — CID 77047357
4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 77047357) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 77047357 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C11H14N4O3/c1-7(8(2)11(17)18)10(16)14-3-4-15-6-12-13-9(15)5-14/h6H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | TZEDIDRRRBYCDI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|