C23H22N4O2 — CID 7704876
3-[(1,3-diphenylpyrazol-4-yl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 7704876) has the molecular formula C23H22N4O2 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-[(1,3-diphenylpyrazol-4-yl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[(1,3-diphenylpyrazol-4-yl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 7704876 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-[(1,3-diphenylpyrazol-4-yl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H22N4O2/c28-21-23(13-7-8-14-23)24-22(29)26(21)15-18-16-27(19-11-5-2-6-12-19)25-20(18)17-9-3-1-4-10-17/h1-6,9-12,16H,7-8,13-15H2,(H,24,29) |
| InChIKey | UKKZAEXEWSDGGB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|