C10H15ClN2S — CID 77051357
4-chloro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]but-2-en-1-amine (PubChem CID 77051357) has the molecular formula C10H15ClN2S and a molecular weight of 230.76 g/mol. Its IUPAC name is 4-chloro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]but-2-en-1-amine.
| Compound Name | 4-chloro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]but-2-en-1-amine |
|---|---|
| PubChem CID | 77051357 |
| Molecular Formula | C10H15ClN2S |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-chloro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]but-2-en-1-amine |
| SMILES | Cc1ncsc1CN(C)CC=CCCl |
| InChI | InChI=1S/C10H15ClN2S/c1-9-10(14-8-12-9)7-13(2)6-4-3-5-11/h3-4,8H,5-7H2,1-2H3 |
| InChIKey | IERVAXTWIRXFDD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|