About 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine
4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine (PubChem CID 77051416) has the molecular formula C10H18ClNS
and a molecular weight of 219.78 g/mol. Its IUPAC name is 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine |
| PubChem CID | 77051416 |
| Molecular Formula | C10H18ClNS |
| Molecular Weight | 219.78 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine |
| SMILES | CC1CN(CC=CCCl)CC(C)S1 |
| InChI | InChI=1S/C10H18ClNS/c1-9-7-12(6-4-3-5-11)8-10(2)13-9/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | KXTJCBCGOIZJNF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine?
The IUPAC name of 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine (CID 77051416) is 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine.
What is the SMILES notation for 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine?
The canonical SMILES for 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine is CC1CN(CC=CCCl)CC(C)S1.
What is the InChIKey of 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine?
The InChIKey is KXTJCBCGOIZJNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18ClNS/c1-9-7-12(6-4-3-5-11)8-10(2)13-9/h3-4,9-10H,5-8H2,1-2H3.
What are the key properties of 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine?
4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine has a molecular weight of 219.78 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorobut-2-enyl)-2,6-dimethylthiomorpholine is sourced from PubChem (CID 77051416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).